About [(2R)-1-[(2S)-2-amino-3,3-dimethylbutanoyl]pyrrolidin-2-yl]boronic acid
[(2R)-1-[(2S)-2-amino-3,3-dimethylbutanoyl]pyrrolidin-2-yl]boronic acid (PubChem CID 10704521) has the molecular formula C10H21BN2O3
and a molecular weight of 228.10 g/mol. Its IUPAC name is [(2R)-1-[(2S)-2-amino-3,3-dimethylbutanoyl]pyrrolidin-2-yl]boronic acid.
Molecular Properties
| Compound Name | [(2R)-1-[(2S)-2-amino-3,3-dimethylbutanoyl]pyrrolidin-2-yl]boronic acid |
| PubChem CID | 10704521 |
| Molecular Formula | C10H21BN2O3 |
| Molecular Weight | 228.10 g/mol |
| Exact Mass | 228.16 |
| IUPAC Name | [(2R)-1-[(2S)-2-amino-3,3-dimethylbutanoyl]pyrrolidin-2-yl]boronic acid |
| SMILES | CC(C)(C)[C@H](N)C(=O)N1CCC[C@H]1B(O)O |
| InChI | InChI=1S/C10H21BN2O3/c1-10(2,3)8(12)9(14)13-6-4-5-7(13)11(15)16/h7-8,15-16H,4-6,12H2,1-3H3/t7-,8+/m0/s1 |
| InChIKey | YLQGXGBOYJWXBT-JGVFFNPUSA-N |
| XLogP | -0.64 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.10 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [(2R)-1-[(2S)-2-amino-3,3-dimethylbutanoyl]pyrrolidin-2-yl]boronic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R)-1-[(2S)-2-amino-3,3-dimethylbutanoyl]pyrrolidin-2-yl]boronic acid?
The IUPAC name of [(2R)-1-[(2S)-2-amino-3,3-dimethylbutanoyl]pyrrolidin-2-yl]boronic acid (CID 10704521) is [(2R)-1-[(2S)-2-amino-3,3-dimethylbutanoyl]pyrrolidin-2-yl]boronic acid.
What is the SMILES notation for [(2R)-1-[(2S)-2-amino-3,3-dimethylbutanoyl]pyrrolidin-2-yl]boronic acid?
The canonical SMILES for [(2R)-1-[(2S)-2-amino-3,3-dimethylbutanoyl]pyrrolidin-2-yl]boronic acid is CC(C)(C)[C@H](N)C(=O)N1CCC[C@H]1B(O)O.
What is the InChIKey of [(2R)-1-[(2S)-2-amino-3,3-dimethylbutanoyl]pyrrolidin-2-yl]boronic acid?
The InChIKey is YLQGXGBOYJWXBT-JGVFFNPUSA-N. The full InChI is InChI=1S/C10H21BN2O3/c1-10(2,3)8(12)9(14)13-6-4-5-7(13)11(15)16/h7-8,15-16H,4-6,12H2,1-3H3/t7-,8+/m0/s1.
What are the key properties of [(2R)-1-[(2S)-2-amino-3,3-dimethylbutanoyl]pyrrolidin-2-yl]boronic acid?
[(2R)-1-[(2S)-2-amino-3,3-dimethylbutanoyl]pyrrolidin-2-yl]boronic acid has a molecular weight of 228.10 g/mol, XLogP of -0.64, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R)-1-[(2S)-2-amino-3,3-dimethylbutanoyl]pyrrolidin-2-yl]boronic acid is sourced from PubChem (CID 10704521), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).