About (5E)-3,3-diethoxynona-1,5-dien-4-ol
(5E)-3,3-diethoxynona-1,5-dien-4-ol (PubChem CID 10704552) has the molecular formula C13H24O3
and a molecular weight of 228.33 g/mol. Its IUPAC name is (5E)-3,3-diethoxynona-1,5-dien-4-ol.
Molecular Properties
| Compound Name | (5E)-3,3-diethoxynona-1,5-dien-4-ol |
| PubChem CID | 10704552 |
| Molecular Formula | C13H24O3 |
| Molecular Weight | 228.33 g/mol |
| Exact Mass | 228.17 |
| IUPAC Name | (5E)-3,3-diethoxynona-1,5-dien-4-ol |
| SMILES | C=CC(OCC)(OCC)C(O)/C=C/CCC |
| InChI | InChI=1S/C13H24O3/c1-5-9-10-11-12(14)13(6-2,15-7-3)16-8-4/h6,10-12,14H,2,5,7-9H2,1,3-4H3/b11-10+ |
| InChIKey | OAXDTYYLEUQCOO-ZHACJKMWSA-N |
| XLogP | 2.66 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.33 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (5E)-3,3-diethoxynona-1,5-dien-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5E)-3,3-diethoxynona-1,5-dien-4-ol?
The IUPAC name of (5E)-3,3-diethoxynona-1,5-dien-4-ol (CID 10704552) is (5E)-3,3-diethoxynona-1,5-dien-4-ol.
What is the SMILES notation for (5E)-3,3-diethoxynona-1,5-dien-4-ol?
The canonical SMILES for (5E)-3,3-diethoxynona-1,5-dien-4-ol is C=CC(OCC)(OCC)C(O)/C=C/CCC.
What is the InChIKey of (5E)-3,3-diethoxynona-1,5-dien-4-ol?
The InChIKey is OAXDTYYLEUQCOO-ZHACJKMWSA-N. The full InChI is InChI=1S/C13H24O3/c1-5-9-10-11-12(14)13(6-2,15-7-3)16-8-4/h6,10-12,14H,2,5,7-9H2,1,3-4H3/b11-10+.
What are the key properties of (5E)-3,3-diethoxynona-1,5-dien-4-ol?
(5E)-3,3-diethoxynona-1,5-dien-4-ol has a molecular weight of 228.33 g/mol, XLogP of 2.66, 9 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5E)-3,3-diethoxynona-1,5-dien-4-ol is sourced from PubChem (CID 10704552), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).