C13H17N3O3 — CID 107045928
1-(3,5-dimethoxyphenyl)-2-(1-methyltriazol-4-yl)ethanol (PubChem CID 107045928) has the molecular formula C13H17N3O3 and a molecular weight of 263.30 g/mol. Its IUPAC name is 1-(3,5-dimethoxyphenyl)-2-(1-methyltriazol-4-yl)ethanol.
| Compound Name | 1-(3,5-dimethoxyphenyl)-2-(1-methyltriazol-4-yl)ethanol |
|---|---|
| PubChem CID | 107045928 |
| Molecular Formula | C13H17N3O3 |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | 1-(3,5-dimethoxyphenyl)-2-(1-methyltriazol-4-yl)ethanol |
| SMILES | COc1cc(OC)cc(C(O)Cc2cn(C)nn2)c1 |
| InChI | InChI=1S/C13H17N3O3/c1-16-8-10(14-15-16)6-13(17)9-4-11(18-2)7-12(5-9)19-3/h4-5,7-8,13,17H,6H2,1-3H3 |
| InChIKey | BPZWWMNLMADGBI-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 69.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |