C14H14ClNO3 — CID 107046386
2-(bicyclo[3.1.0]hexane-3-carbonylamino)-3-chlorobenzoic acid (PubChem CID 107046386) has the molecular formula C14H14ClNO3 and a molecular weight of 279.72 g/mol. Its IUPAC name is 2-(bicyclo[3.1.0]hexane-3-carbonylamino)-3-chlorobenzoic acid.
| Compound Name | 2-(bicyclo[3.1.0]hexane-3-carbonylamino)-3-chlorobenzoic acid |
|---|---|
| PubChem CID | 107046386 |
| Molecular Formula | C14H14ClNO3 |
| Molecular Weight | 279.72 g/mol |
| Exact Mass | 279.07 |
| IUPAC Name | 2-(bicyclo[3.1.0]hexane-3-carbonylamino)-3-chlorobenzoic acid |
| SMILES | O=C(O)c1cccc(Cl)c1NC(=O)C1CC2CC2C1 |
| InChI | InChI=1S/C14H14ClNO3/c15-11-3-1-2-10(14(18)19)12(11)16-13(17)9-5-7-4-8(7)6-9/h1-3,7-9H,4-6H2,(H,16,17)(H,18,19) |
| InChIKey | WZZQUDRELVHQQL-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.72 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |