C10H8F2N4O — CID 107046842
1-(3,4-difluorophenyl)-2-(2-methyltetrazol-5-yl)ethanone (PubChem CID 107046842) has the molecular formula C10H8F2N4O and a molecular weight of 238.20 g/mol. Its IUPAC name is 1-(3,4-difluorophenyl)-2-(2-methyltetrazol-5-yl)ethanone.
| Compound Name | 1-(3,4-difluorophenyl)-2-(2-methyltetrazol-5-yl)ethanone |
|---|---|
| PubChem CID | 107046842 |
| Molecular Formula | C10H8F2N4O |
| Molecular Weight | 238.20 g/mol |
| Exact Mass | 238.07 |
| IUPAC Name | 1-(3,4-difluorophenyl)-2-(2-methyltetrazol-5-yl)ethanone |
| SMILES | Cn1nnc(CC(=O)c2ccc(F)c(F)c2)n1 |
| InChI | InChI=1S/C10H8F2N4O/c1-16-14-10(13-15-16)5-9(17)6-2-3-7(11)8(12)4-6/h2-4H,5H2,1H3 |
| InChIKey | MHWDJKUZLBPPAZ-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 60.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.20 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |