C13H10ClNO3S — CID 107046881
3-chloro-2-[(3-methylthiophene-2-carbonyl)amino]benzoic acid (PubChem CID 107046881) has the molecular formula C13H10ClNO3S and a molecular weight of 295.75 g/mol. Its IUPAC name is 3-chloro-2-[(3-methylthiophene-2-carbonyl)amino]benzoic acid.
| Compound Name | 3-chloro-2-[(3-methylthiophene-2-carbonyl)amino]benzoic acid |
|---|---|
| PubChem CID | 107046881 |
| Molecular Formula | C13H10ClNO3S |
| Molecular Weight | 295.75 g/mol |
| Exact Mass | 295.01 |
| IUPAC Name | 3-chloro-2-[(3-methylthiophene-2-carbonyl)amino]benzoic acid |
| SMILES | Cc1ccsc1C(=O)Nc1c(Cl)cccc1C(=O)O |
| InChI | InChI=1S/C13H10ClNO3S/c1-7-5-6-19-11(7)12(16)15-10-8(13(17)18)3-2-4-9(10)14/h2-6H,1H3,(H,15,16)(H,17,18) |
| InChIKey | VFEZEAFHBBOOTD-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.75 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |