About 7'-methylspiro[cyclohexane-1,2'-pyrano[4,3-b]pyran]-5'-one
7'-methylspiro[cyclohexane-1,2'-pyrano[4,3-b]pyran]-5'-one (PubChem CID 10704733) has the molecular formula C14H16O3
and a molecular weight of 232.28 g/mol. Its IUPAC name is 7'-methylspiro[cyclohexane-1,2'-pyrano[4,3-b]pyran]-5'-one.
Molecular Properties
| Compound Name | 7'-methylspiro[cyclohexane-1,2'-pyrano[4,3-b]pyran]-5'-one |
| PubChem CID | 10704733 |
| Molecular Formula | C14H16O3 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.11 |
| IUPAC Name | 7'-methylspiro[cyclohexane-1,2'-pyrano[4,3-b]pyran]-5'-one |
| SMILES | Cc1cc2c(c(=O)o1)C=CC1(CCCCC1)O2 |
| InChI | InChI=1S/C14H16O3/c1-10-9-12-11(13(15)16-10)5-8-14(17-12)6-3-2-4-7-14/h5,8-9H,2-4,6-7H2,1H3 |
| InChIKey | XAYVDPOFQAWONM-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7'-methylspiro[cyclohexane-1,2'-pyrano[4,3-b]pyran]-5'-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7'-methylspiro[cyclohexane-1,2'-pyrano[4,3-b]pyran]-5'-one?
The IUPAC name of 7'-methylspiro[cyclohexane-1,2'-pyrano[4,3-b]pyran]-5'-one (CID 10704733) is 7'-methylspiro[cyclohexane-1,2'-pyrano[4,3-b]pyran]-5'-one.
What is the SMILES notation for 7'-methylspiro[cyclohexane-1,2'-pyrano[4,3-b]pyran]-5'-one?
The canonical SMILES for 7'-methylspiro[cyclohexane-1,2'-pyrano[4,3-b]pyran]-5'-one is Cc1cc2c(c(=O)o1)C=CC1(CCCCC1)O2.
What is the InChIKey of 7'-methylspiro[cyclohexane-1,2'-pyrano[4,3-b]pyran]-5'-one?
The InChIKey is XAYVDPOFQAWONM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16O3/c1-10-9-12-11(13(15)16-10)5-8-14(17-12)6-3-2-4-7-14/h5,8-9H,2-4,6-7H2,1H3.
What are the key properties of 7'-methylspiro[cyclohexane-1,2'-pyrano[4,3-b]pyran]-5'-one?
7'-methylspiro[cyclohexane-1,2'-pyrano[4,3-b]pyran]-5'-one has a molecular weight of 232.28 g/mol, XLogP of 3.06, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7'-methylspiro[cyclohexane-1,2'-pyrano[4,3-b]pyran]-5'-one is sourced from PubChem (CID 10704733), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).