About 1-chloro-1,1-difluoro-3-(2-methyltetrazol-5-yl)propan-2-one
1-chloro-1,1-difluoro-3-(2-methyltetrazol-5-yl)propan-2-one (PubChem CID 107047437) has the molecular formula C5H5ClF2N4O
and a molecular weight of 210.57 g/mol. Its IUPAC name is 1-chloro-1,1-difluoro-3-(2-methyltetrazol-5-yl)propan-2-one.
Molecular Properties
| Compound Name | 1-chloro-1,1-difluoro-3-(2-methyltetrazol-5-yl)propan-2-one |
| PubChem CID | 107047437 |
| Molecular Formula | C5H5ClF2N4O |
| Molecular Weight | 210.57 g/mol |
| Exact Mass | 210.01 |
| IUPAC Name | 1-chloro-1,1-difluoro-3-(2-methyltetrazol-5-yl)propan-2-one |
| SMILES | Cn1nnc(CC(=O)C(F)(F)Cl)n1 |
| InChI | InChI=1S/C5H5ClF2N4O/c1-12-10-4(9-11-12)2-3(13)5(6,7)8/h2H2,1H3 |
| InChIKey | GZEHZIFKNLMXFQ-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 60.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.57 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-chloro-1,1-difluoro-3-(2-methyltetrazol-5-yl)propan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-1,1-difluoro-3-(2-methyltetrazol-5-yl)propan-2-one?
The IUPAC name of 1-chloro-1,1-difluoro-3-(2-methyltetrazol-5-yl)propan-2-one (CID 107047437) is 1-chloro-1,1-difluoro-3-(2-methyltetrazol-5-yl)propan-2-one.
What is the SMILES notation for 1-chloro-1,1-difluoro-3-(2-methyltetrazol-5-yl)propan-2-one?
The canonical SMILES for 1-chloro-1,1-difluoro-3-(2-methyltetrazol-5-yl)propan-2-one is Cn1nnc(CC(=O)C(F)(F)Cl)n1.
What is the InChIKey of 1-chloro-1,1-difluoro-3-(2-methyltetrazol-5-yl)propan-2-one?
The InChIKey is GZEHZIFKNLMXFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5ClF2N4O/c1-12-10-4(9-11-12)2-3(13)5(6,7)8/h2H2,1H3.
What are the key properties of 1-chloro-1,1-difluoro-3-(2-methyltetrazol-5-yl)propan-2-one?
1-chloro-1,1-difluoro-3-(2-methyltetrazol-5-yl)propan-2-one has a molecular weight of 210.57 g/mol, XLogP of 0.15, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-1,1-difluoro-3-(2-methyltetrazol-5-yl)propan-2-one is sourced from PubChem (CID 107047437), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).