C6H6ClF2N3O — CID 107047439
1-chloro-1,1-difluoro-3-(1-methyltriazol-4-yl)propan-2-one (PubChem CID 107047439) has the molecular formula C6H6ClF2N3O and a molecular weight of 209.58 g/mol. Its IUPAC name is 1-chloro-1,1-difluoro-3-(1-methyltriazol-4-yl)propan-2-one.
| Compound Name | 1-chloro-1,1-difluoro-3-(1-methyltriazol-4-yl)propan-2-one |
|---|---|
| PubChem CID | 107047439 |
| Molecular Formula | C6H6ClF2N3O |
| Molecular Weight | 209.58 g/mol |
| Exact Mass | 209.02 |
| IUPAC Name | 1-chloro-1,1-difluoro-3-(1-methyltriazol-4-yl)propan-2-one |
| SMILES | Cn1cc(CC(=O)C(F)(F)Cl)nn1 |
| InChI | InChI=1S/C6H6ClF2N3O/c1-12-3-4(10-11-12)2-5(13)6(7,8)9/h3H,2H2,1H3 |
| InChIKey | NTUSMOLLQBWARG-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.58 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|