About 2,5-bis(methylsulfanyl)thieno[3,2-b]thiophene
2,5-bis(methylsulfanyl)thieno[3,2-b]thiophene (PubChem CID 10704763) has the molecular formula C8H8S4
and a molecular weight of 232.42 g/mol. Its IUPAC name is 2,5-bis(methylsulfanyl)thieno[3,2-b]thiophene.
Molecular Properties
| Compound Name | 2,5-bis(methylsulfanyl)thieno[3,2-b]thiophene |
| PubChem CID | 10704763 |
| Molecular Formula | C8H8S4 |
| Molecular Weight | 232.42 g/mol |
| Exact Mass | 231.95 |
| IUPAC Name | 2,5-bis(methylsulfanyl)thieno[3,2-b]thiophene |
| SMILES | CSc1cc2sc(SC)cc2s1 |
| InChI | InChI=1S/C8H8S4/c1-9-7-3-5-6(11-7)4-8(10-2)12-5/h3-4H,1-2H3 |
| InChIKey | UMOMCZXYEOSJBF-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.42 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2,5-bis(methylsulfanyl)thieno[3,2-b]thiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-bis(methylsulfanyl)thieno[3,2-b]thiophene?
The IUPAC name of 2,5-bis(methylsulfanyl)thieno[3,2-b]thiophene (CID 10704763) is 2,5-bis(methylsulfanyl)thieno[3,2-b]thiophene.
What is the SMILES notation for 2,5-bis(methylsulfanyl)thieno[3,2-b]thiophene?
The canonical SMILES for 2,5-bis(methylsulfanyl)thieno[3,2-b]thiophene is CSc1cc2sc(SC)cc2s1.
What is the InChIKey of 2,5-bis(methylsulfanyl)thieno[3,2-b]thiophene?
The InChIKey is UMOMCZXYEOSJBF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8S4/c1-9-7-3-5-6(11-7)4-8(10-2)12-5/h3-4H,1-2H3.
What are the key properties of 2,5-bis(methylsulfanyl)thieno[3,2-b]thiophene?
2,5-bis(methylsulfanyl)thieno[3,2-b]thiophene has a molecular weight of 232.42 g/mol, XLogP of 4.41, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-bis(methylsulfanyl)thieno[3,2-b]thiophene is sourced from PubChem (CID 10704763), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).