C8H10F4N4O2 — CID 107047666
1-(2-methyltetrazol-5-yl)-3-(2,2,3,3-tetrafluoropropoxy)propan-2-one (PubChem CID 107047666) has the molecular formula C8H10F4N4O2 and a molecular weight of 270.19 g/mol. Its IUPAC name is 1-(2-methyltetrazol-5-yl)-3-(2,2,3,3-tetrafluoropropoxy)propan-2-one.
| Compound Name | 1-(2-methyltetrazol-5-yl)-3-(2,2,3,3-tetrafluoropropoxy)propan-2-one |
|---|---|
| PubChem CID | 107047666 |
| Molecular Formula | C8H10F4N4O2 |
| Molecular Weight | 270.19 g/mol |
| Exact Mass | 270.07 |
| IUPAC Name | 1-(2-methyltetrazol-5-yl)-3-(2,2,3,3-tetrafluoropropoxy)propan-2-one |
| SMILES | Cn1nnc(CC(=O)COCC(F)(F)C(F)F)n1 |
| InChI | InChI=1S/C8H10F4N4O2/c1-16-14-6(13-15-16)2-5(17)3-18-4-8(11,12)7(9)10/h7H,2-4H2,1H3 |
| InChIKey | NWHDCPBDGQIQSV-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 69.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.19 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|