C12H14FN3OS — CID 107047898
1-(2-fluorophenyl)sulfanyl-3-(1-methyltriazol-4-yl)propan-2-ol (PubChem CID 107047898) has the molecular formula C12H14FN3OS and a molecular weight of 267.33 g/mol. Its IUPAC name is 1-(2-fluorophenyl)sulfanyl-3-(1-methyltriazol-4-yl)propan-2-ol.
| Compound Name | 1-(2-fluorophenyl)sulfanyl-3-(1-methyltriazol-4-yl)propan-2-ol |
|---|---|
| PubChem CID | 107047898 |
| Molecular Formula | C12H14FN3OS |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.08 |
| IUPAC Name | 1-(2-fluorophenyl)sulfanyl-3-(1-methyltriazol-4-yl)propan-2-ol |
| SMILES | Cn1cc(CC(O)CSc2ccccc2F)nn1 |
| InChI | InChI=1S/C12H14FN3OS/c1-16-7-9(14-15-16)6-10(17)8-18-12-5-3-2-4-11(12)13/h2-5,7,10,17H,6,8H2,1H3 |
| InChIKey | GSHAAABKOUSFDN-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |