About 3-methoxy-4,4-dimethyl-1-(2-methyltetrazol-5-yl)pentan-2-ol
3-methoxy-4,4-dimethyl-1-(2-methyltetrazol-5-yl)pentan-2-ol (PubChem CID 107048153) has the molecular formula C10H20N4O2
and a molecular weight of 228.30 g/mol. Its IUPAC name is 3-methoxy-4,4-dimethyl-1-(2-methyltetrazol-5-yl)pentan-2-ol.
Molecular Properties
| Compound Name | 3-methoxy-4,4-dimethyl-1-(2-methyltetrazol-5-yl)pentan-2-ol |
| PubChem CID | 107048153 |
| Molecular Formula | C10H20N4O2 |
| Molecular Weight | 228.30 g/mol |
| Exact Mass | 228.16 |
| IUPAC Name | 3-methoxy-4,4-dimethyl-1-(2-methyltetrazol-5-yl)pentan-2-ol |
| SMILES | COC(C(O)Cc1nnn(C)n1)C(C)(C)C |
| InChI | InChI=1S/C10H20N4O2/c1-10(2,3)9(16-5)7(15)6-8-11-13-14(4)12-8/h7,9,15H,6H2,1-5H3 |
| InChIKey | BWTXLSGKAKJVIQ-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.30 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-methoxy-4,4-dimethyl-1-(2-methyltetrazol-5-yl)pentan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methoxy-4,4-dimethyl-1-(2-methyltetrazol-5-yl)pentan-2-ol?
The IUPAC name of 3-methoxy-4,4-dimethyl-1-(2-methyltetrazol-5-yl)pentan-2-ol (CID 107048153) is 3-methoxy-4,4-dimethyl-1-(2-methyltetrazol-5-yl)pentan-2-ol.
What is the SMILES notation for 3-methoxy-4,4-dimethyl-1-(2-methyltetrazol-5-yl)pentan-2-ol?
The canonical SMILES for 3-methoxy-4,4-dimethyl-1-(2-methyltetrazol-5-yl)pentan-2-ol is COC(C(O)Cc1nnn(C)n1)C(C)(C)C.
What is the InChIKey of 3-methoxy-4,4-dimethyl-1-(2-methyltetrazol-5-yl)pentan-2-ol?
The InChIKey is BWTXLSGKAKJVIQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20N4O2/c1-10(2,3)9(16-5)7(15)6-8-11-13-14(4)12-8/h7,9,15H,6H2,1-5H3.
What are the key properties of 3-methoxy-4,4-dimethyl-1-(2-methyltetrazol-5-yl)pentan-2-ol?
3-methoxy-4,4-dimethyl-1-(2-methyltetrazol-5-yl)pentan-2-ol has a molecular weight of 228.30 g/mol, XLogP of 0.17, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methoxy-4,4-dimethyl-1-(2-methyltetrazol-5-yl)pentan-2-ol is sourced from PubChem (CID 107048153), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).