About 3-ethoxy-4,4-dimethyl-1-(2-methyltetrazol-5-yl)pentan-2-ol
3-ethoxy-4,4-dimethyl-1-(2-methyltetrazol-5-yl)pentan-2-ol (PubChem CID 107048155) has the molecular formula C11H22N4O2
and a molecular weight of 242.32 g/mol. Its IUPAC name is 3-ethoxy-4,4-dimethyl-1-(2-methyltetrazol-5-yl)pentan-2-ol.
Molecular Properties
| Compound Name | 3-ethoxy-4,4-dimethyl-1-(2-methyltetrazol-5-yl)pentan-2-ol |
| PubChem CID | 107048155 |
| Molecular Formula | C11H22N4O2 |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.17 |
| IUPAC Name | 3-ethoxy-4,4-dimethyl-1-(2-methyltetrazol-5-yl)pentan-2-ol |
| SMILES | CCOC(C(O)Cc1nnn(C)n1)C(C)(C)C |
| InChI | InChI=1S/C11H22N4O2/c1-6-17-10(11(2,3)4)8(16)7-9-12-14-15(5)13-9/h8,10,16H,6-7H2,1-5H3 |
| InChIKey | ZKOLQLFVRCGAAT-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-ethoxy-4,4-dimethyl-1-(2-methyltetrazol-5-yl)pentan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethoxy-4,4-dimethyl-1-(2-methyltetrazol-5-yl)pentan-2-ol?
The IUPAC name of 3-ethoxy-4,4-dimethyl-1-(2-methyltetrazol-5-yl)pentan-2-ol (CID 107048155) is 3-ethoxy-4,4-dimethyl-1-(2-methyltetrazol-5-yl)pentan-2-ol.
What is the SMILES notation for 3-ethoxy-4,4-dimethyl-1-(2-methyltetrazol-5-yl)pentan-2-ol?
The canonical SMILES for 3-ethoxy-4,4-dimethyl-1-(2-methyltetrazol-5-yl)pentan-2-ol is CCOC(C(O)Cc1nnn(C)n1)C(C)(C)C.
What is the InChIKey of 3-ethoxy-4,4-dimethyl-1-(2-methyltetrazol-5-yl)pentan-2-ol?
The InChIKey is ZKOLQLFVRCGAAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22N4O2/c1-6-17-10(11(2,3)4)8(16)7-9-12-14-15(5)13-9/h8,10,16H,6-7H2,1-5H3.
What are the key properties of 3-ethoxy-4,4-dimethyl-1-(2-methyltetrazol-5-yl)pentan-2-ol?
3-ethoxy-4,4-dimethyl-1-(2-methyltetrazol-5-yl)pentan-2-ol has a molecular weight of 242.32 g/mol, XLogP of 0.56, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethoxy-4,4-dimethyl-1-(2-methyltetrazol-5-yl)pentan-2-ol is sourced from PubChem (CID 107048155), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).