C9H18N4O2 — CID 107048229
3-ethyl-1-(2-methyltetrazol-5-yl)pentane-2,3-diol (PubChem CID 107048229) has the molecular formula C9H18N4O2 and a molecular weight of 214.27 g/mol. Its IUPAC name is 3-ethyl-1-(2-methyltetrazol-5-yl)pentane-2,3-diol.
| Compound Name | 3-ethyl-1-(2-methyltetrazol-5-yl)pentane-2,3-diol |
|---|---|
| PubChem CID | 107048229 |
| Molecular Formula | C9H18N4O2 |
| Molecular Weight | 214.27 g/mol |
| Exact Mass | 214.14 |
| IUPAC Name | 3-ethyl-1-(2-methyltetrazol-5-yl)pentane-2,3-diol |
| SMILES | CCC(O)(CC)C(O)Cc1nnn(C)n1 |
| InChI | InChI=1S/C9H18N4O2/c1-4-9(15,5-2)7(14)6-8-10-12-13(3)11-8/h7,14-15H,4-6H2,1-3H3 |
| InChIKey | RIRMWVCEONHQCW-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 84.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.27 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |