About 4,4-dimethyl-1-(2-methyltetrazol-5-yl)pentane-2,3-diol
4,4-dimethyl-1-(2-methyltetrazol-5-yl)pentane-2,3-diol (PubChem CID 107048247) has the molecular formula C9H18N4O2
and a molecular weight of 214.27 g/mol. Its IUPAC name is 4,4-dimethyl-1-(2-methyltetrazol-5-yl)pentane-2,3-diol.
Molecular Properties
| Compound Name | 4,4-dimethyl-1-(2-methyltetrazol-5-yl)pentane-2,3-diol |
| PubChem CID | 107048247 |
| Molecular Formula | C9H18N4O2 |
| Molecular Weight | 214.27 g/mol |
| Exact Mass | 214.14 |
| IUPAC Name | 4,4-dimethyl-1-(2-methyltetrazol-5-yl)pentane-2,3-diol |
| SMILES | Cn1nnc(CC(O)C(O)C(C)(C)C)n1 |
| InChI | InChI=1S/C9H18N4O2/c1-9(2,3)8(15)6(14)5-7-10-12-13(4)11-7/h6,8,14-15H,5H2,1-4H3 |
| InChIKey | UXHSIBDLFAMOIP-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 84.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.27 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4,4-dimethyl-1-(2-methyltetrazol-5-yl)pentane-2,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,4-dimethyl-1-(2-methyltetrazol-5-yl)pentane-2,3-diol?
The IUPAC name of 4,4-dimethyl-1-(2-methyltetrazol-5-yl)pentane-2,3-diol (CID 107048247) is 4,4-dimethyl-1-(2-methyltetrazol-5-yl)pentane-2,3-diol.
What is the SMILES notation for 4,4-dimethyl-1-(2-methyltetrazol-5-yl)pentane-2,3-diol?
The canonical SMILES for 4,4-dimethyl-1-(2-methyltetrazol-5-yl)pentane-2,3-diol is Cn1nnc(CC(O)C(O)C(C)(C)C)n1.
What is the InChIKey of 4,4-dimethyl-1-(2-methyltetrazol-5-yl)pentane-2,3-diol?
The InChIKey is UXHSIBDLFAMOIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18N4O2/c1-9(2,3)8(15)6(14)5-7-10-12-13(4)11-7/h6,8,14-15H,5H2,1-4H3.
What are the key properties of 4,4-dimethyl-1-(2-methyltetrazol-5-yl)pentane-2,3-diol?
4,4-dimethyl-1-(2-methyltetrazol-5-yl)pentane-2,3-diol has a molecular weight of 214.27 g/mol, XLogP of -0.48, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4,4-dimethyl-1-(2-methyltetrazol-5-yl)pentane-2,3-diol is sourced from PubChem (CID 107048247), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).