About N-ethyl-4,4,4-trifluoro-1-(2-methyltetrazol-5-yl)butan-2-amine
N-ethyl-4,4,4-trifluoro-1-(2-methyltetrazol-5-yl)butan-2-amine (PubChem CID 107048754) has the molecular formula C8H14F3N5
and a molecular weight of 237.23 g/mol. Its IUPAC name is N-ethyl-4,4,4-trifluoro-1-(2-methyltetrazol-5-yl)butan-2-amine.
Molecular Properties
| Compound Name | N-ethyl-4,4,4-trifluoro-1-(2-methyltetrazol-5-yl)butan-2-amine |
| PubChem CID | 107048754 |
| Molecular Formula | C8H14F3N5 |
| Molecular Weight | 237.23 g/mol |
| Exact Mass | 237.12 |
| IUPAC Name | N-ethyl-4,4,4-trifluoro-1-(2-methyltetrazol-5-yl)butan-2-amine |
| SMILES | CCNC(Cc1nnn(C)n1)CC(F)(F)F |
| InChI | InChI=1S/C8H14F3N5/c1-3-12-6(5-8(9,10)11)4-7-13-15-16(2)14-7/h6,12H,3-5H2,1-2H3 |
| InChIKey | CKQTYGOXMLIDPH-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.23 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-ethyl-4,4,4-trifluoro-1-(2-methyltetrazol-5-yl)butan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-4,4,4-trifluoro-1-(2-methyltetrazol-5-yl)butan-2-amine?
The IUPAC name of N-ethyl-4,4,4-trifluoro-1-(2-methyltetrazol-5-yl)butan-2-amine (CID 107048754) is N-ethyl-4,4,4-trifluoro-1-(2-methyltetrazol-5-yl)butan-2-amine.
What is the SMILES notation for N-ethyl-4,4,4-trifluoro-1-(2-methyltetrazol-5-yl)butan-2-amine?
The canonical SMILES for N-ethyl-4,4,4-trifluoro-1-(2-methyltetrazol-5-yl)butan-2-amine is CCNC(Cc1nnn(C)n1)CC(F)(F)F.
What is the InChIKey of N-ethyl-4,4,4-trifluoro-1-(2-methyltetrazol-5-yl)butan-2-amine?
The InChIKey is CKQTYGOXMLIDPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14F3N5/c1-3-12-6(5-8(9,10)11)4-7-13-15-16(2)14-7/h6,12H,3-5H2,1-2H3.
What are the key properties of N-ethyl-4,4,4-trifluoro-1-(2-methyltetrazol-5-yl)butan-2-amine?
N-ethyl-4,4,4-trifluoro-1-(2-methyltetrazol-5-yl)butan-2-amine has a molecular weight of 237.23 g/mol, XLogP of 0.68, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-4,4,4-trifluoro-1-(2-methyltetrazol-5-yl)butan-2-amine is sourced from PubChem (CID 107048754), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).