C15H26Si — CID 10704881
3-butylocta-1,2-dien-7-ynyl(trimethyl)silane (PubChem CID 10704881) has the molecular formula C15H26Si and a molecular weight of 234.46 g/mol. Its IUPAC name is 3-butylocta-1,2-dien-7-ynyl(trimethyl)silane.
| Compound Name | 3-butylocta-1,2-dien-7-ynyl(trimethyl)silane |
|---|---|
| PubChem CID | 10704881 |
| Molecular Formula | C15H26Si |
| Molecular Weight | 234.46 g/mol |
| Exact Mass | 234.18 |
| IUPAC Name | 3-butylocta-1,2-dien-7-ynyl(trimethyl)silane |
| SMILES | C#CCCCC(=C=C[Si](C)(C)C)CCCC |
| InChI | InChI=1S/C15H26Si/c1-6-8-10-12-15(11-9-7-2)13-14-16(3,4)5/h1,14H,7-12H2,2-5H3 |
| InChIKey | LKIFEUJDSCTUPQ-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.46 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|