About 2-[2-(3,5-ditert-butylphenyl)sulfonylethyl]pyridine
2-[2-(3,5-ditert-butylphenyl)sulfonylethyl]pyridine (PubChem CID 1070490) has the molecular formula C21H29NO2S
and a molecular weight of 359.54 g/mol. Its IUPAC name is 2-[2-(3,5-ditert-butylphenyl)sulfonylethyl]pyridine.
Molecular Properties
| Compound Name | 2-[2-(3,5-ditert-butylphenyl)sulfonylethyl]pyridine |
| PubChem CID | 1070490 |
| Molecular Formula | C21H29NO2S |
| Molecular Weight | 359.54 g/mol |
| Exact Mass | 359.19 |
| IUPAC Name | 2-[2-(3,5-ditert-butylphenyl)sulfonylethyl]pyridine |
| SMILES | CC(C)(C)c1cc(C(C)(C)C)cc(S(=O)(=O)CCc2ccccn2)c1 |
| InChI | InChI=1S/C21H29NO2S/c1-20(2,3)16-13-17(21(4,5)6)15-19(14-16)25(23,24)12-10-18-9-7-8-11-22-18/h7-9,11,13-15H,10,12H2,1-6H3 |
| InChIKey | GLFXRZRREBOQPP-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.54 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[2-(3,5-ditert-butylphenyl)sulfonylethyl]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(3,5-ditert-butylphenyl)sulfonylethyl]pyridine?
The IUPAC name of 2-[2-(3,5-ditert-butylphenyl)sulfonylethyl]pyridine (CID 1070490) is 2-[2-(3,5-ditert-butylphenyl)sulfonylethyl]pyridine.
What is the SMILES notation for 2-[2-(3,5-ditert-butylphenyl)sulfonylethyl]pyridine?
The canonical SMILES for 2-[2-(3,5-ditert-butylphenyl)sulfonylethyl]pyridine is CC(C)(C)c1cc(C(C)(C)C)cc(S(=O)(=O)CCc2ccccn2)c1.
What is the InChIKey of 2-[2-(3,5-ditert-butylphenyl)sulfonylethyl]pyridine?
The InChIKey is GLFXRZRREBOQPP-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H29NO2S/c1-20(2,3)16-13-17(21(4,5)6)15-19(14-16)25(23,24)12-10-18-9-7-8-11-22-18/h7-9,11,13-15H,10,12H2,1-6H3.
What are the key properties of 2-[2-(3,5-ditert-butylphenyl)sulfonylethyl]pyridine?
2-[2-(3,5-ditert-butylphenyl)sulfonylethyl]pyridine has a molecular weight of 359.54 g/mol, XLogP of 4.69, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(3,5-ditert-butylphenyl)sulfonylethyl]pyridine is sourced from PubChem (CID 1070490), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).