C9H16O5S — CID 10704961
methyl (2S,3R)-4-tert-butylsulfanyl-2,3-dihydroxy-4-oxobutanoate (PubChem CID 10704961) has the molecular formula C9H16O5S and a molecular weight of 236.29 g/mol. Its IUPAC name is methyl (2S,3R)-4-tert-butylsulfanyl-2,3-dihydroxy-4-oxobutanoate.
| Compound Name | methyl (2S,3R)-4-tert-butylsulfanyl-2,3-dihydroxy-4-oxobutanoate |
|---|---|
| PubChem CID | 10704961 |
| Molecular Formula | C9H16O5S |
| Molecular Weight | 236.29 g/mol |
| Exact Mass | 236.07 |
| IUPAC Name | methyl (2S,3R)-4-tert-butylsulfanyl-2,3-dihydroxy-4-oxobutanoate |
| SMILES | COC(=O)[C@@H](O)[C@@H](O)C(=O)SC(C)(C)C |
| InChI | InChI=1S/C9H16O5S/c1-9(2,3)15-8(13)6(11)5(10)7(12)14-4/h5-6,10-11H,1-4H3/t5-,6+/m0/s1 |
| InChIKey | NPHVUSQFMWBLBF-NTSWFWBYSA-N |
| XLogP | -0.06 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.29 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|