C15H24O2 — CID 10704986
2-[[(1S,4S,6R,7S)-4,8,8-trimethyl-7-bicyclo[4.2.0]octanyl]methyl]prop-2-enoic acid (PubChem CID 10704986) has the molecular formula C15H24O2 and a molecular weight of 236.35 g/mol. Its IUPAC name is 2-[[(1S,4S,6R,7S)-4,8,8-trimethyl-7-bicyclo[4.2.0]octanyl]methyl]prop-2-enoic acid.
| Compound Name | 2-[[(1S,4S,6R,7S)-4,8,8-trimethyl-7-bicyclo[4.2.0]octanyl]methyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 10704986 |
| Molecular Formula | C15H24O2 |
| Molecular Weight | 236.35 g/mol |
| Exact Mass | 236.18 |
| IUPAC Name | 2-[[(1S,4S,6R,7S)-4,8,8-trimethyl-7-bicyclo[4.2.0]octanyl]methyl]prop-2-enoic acid |
| SMILES | C=C(C[C@H]1[C@@H]2C[C@@H](C)CC[C@@H]2C1(C)C)C(=O)O |
| InChI | InChI=1S/C15H24O2/c1-9-5-6-12-11(7-9)13(15(12,3)4)8-10(2)14(16)17/h9,11-13H,2,5-8H2,1,3-4H3,(H,16,17)/t9-,11+,12-,13-/m0/s1 |
| InChIKey | AQDYYGWFEQTJGH-RYDUCSDGSA-N |
| XLogP | 3.73 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.35 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|