About 3-N-ethyl-1-N,1-N-dimethyl-4-(2-methyltetrazol-5-yl)butane-1,3-diamine
3-N-ethyl-1-N,1-N-dimethyl-4-(2-methyltetrazol-5-yl)butane-1,3-diamine (PubChem CID 107050603) has the molecular formula C10H22N6
and a molecular weight of 226.33 g/mol. Its IUPAC name is 3-N-ethyl-1-N,1-N-dimethyl-4-(2-methyltetrazol-5-yl)butane-1,3-diamine.
Molecular Properties
| Compound Name | 3-N-ethyl-1-N,1-N-dimethyl-4-(2-methyltetrazol-5-yl)butane-1,3-diamine |
| PubChem CID | 107050603 |
| Molecular Formula | C10H22N6 |
| Molecular Weight | 226.33 g/mol |
| Exact Mass | 226.19 |
| IUPAC Name | 3-N-ethyl-1-N,1-N-dimethyl-4-(2-methyltetrazol-5-yl)butane-1,3-diamine |
| SMILES | CCNC(CCN(C)C)Cc1nnn(C)n1 |
| InChI | InChI=1S/C10H22N6/c1-5-11-9(6-7-15(2)3)8-10-12-14-16(4)13-10/h9,11H,5-8H2,1-4H3 |
| InChIKey | HVRXNHNQJNKKKT-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 58.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.33 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-N-ethyl-1-N,1-N-dimethyl-4-(2-methyltetrazol-5-yl)butane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-N-ethyl-1-N,1-N-dimethyl-4-(2-methyltetrazol-5-yl)butane-1,3-diamine?
The IUPAC name of 3-N-ethyl-1-N,1-N-dimethyl-4-(2-methyltetrazol-5-yl)butane-1,3-diamine (CID 107050603) is 3-N-ethyl-1-N,1-N-dimethyl-4-(2-methyltetrazol-5-yl)butane-1,3-diamine.
What is the SMILES notation for 3-N-ethyl-1-N,1-N-dimethyl-4-(2-methyltetrazol-5-yl)butane-1,3-diamine?
The canonical SMILES for 3-N-ethyl-1-N,1-N-dimethyl-4-(2-methyltetrazol-5-yl)butane-1,3-diamine is CCNC(CCN(C)C)Cc1nnn(C)n1.
What is the InChIKey of 3-N-ethyl-1-N,1-N-dimethyl-4-(2-methyltetrazol-5-yl)butane-1,3-diamine?
The InChIKey is HVRXNHNQJNKKKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H22N6/c1-5-11-9(6-7-15(2)3)8-10-12-14-16(4)13-10/h9,11H,5-8H2,1-4H3.
What are the key properties of 3-N-ethyl-1-N,1-N-dimethyl-4-(2-methyltetrazol-5-yl)butane-1,3-diamine?
3-N-ethyl-1-N,1-N-dimethyl-4-(2-methyltetrazol-5-yl)butane-1,3-diamine has a molecular weight of 226.33 g/mol, XLogP of -0.32, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-N-ethyl-1-N,1-N-dimethyl-4-(2-methyltetrazol-5-yl)butane-1,3-diamine is sourced from PubChem (CID 107050603), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).