About 1-N,1-N-dimethyl-4-(2-methyltetrazol-5-yl)-3-N-propylbutane-1,3-diamine
1-N,1-N-dimethyl-4-(2-methyltetrazol-5-yl)-3-N-propylbutane-1,3-diamine (PubChem CID 107050606) has the molecular formula C11H24N6
and a molecular weight of 240.35 g/mol. Its IUPAC name is 1-N,1-N-dimethyl-4-(2-methyltetrazol-5-yl)-3-N-propylbutane-1,3-diamine.
Molecular Properties
| Compound Name | 1-N,1-N-dimethyl-4-(2-methyltetrazol-5-yl)-3-N-propylbutane-1,3-diamine |
| PubChem CID | 107050606 |
| Molecular Formula | C11H24N6 |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.21 |
| IUPAC Name | 1-N,1-N-dimethyl-4-(2-methyltetrazol-5-yl)-3-N-propylbutane-1,3-diamine |
| SMILES | CCCNC(CCN(C)C)Cc1nnn(C)n1 |
| InChI | InChI=1S/C11H24N6/c1-5-7-12-10(6-8-16(2)3)9-11-13-15-17(4)14-11/h10,12H,5-9H2,1-4H3 |
| InChIKey | YWVJOXLUMYZERR-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 58.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-N,1-N-dimethyl-4-(2-methyltetrazol-5-yl)-3-N-propylbutane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-N,1-N-dimethyl-4-(2-methyltetrazol-5-yl)-3-N-propylbutane-1,3-diamine?
The IUPAC name of 1-N,1-N-dimethyl-4-(2-methyltetrazol-5-yl)-3-N-propylbutane-1,3-diamine (CID 107050606) is 1-N,1-N-dimethyl-4-(2-methyltetrazol-5-yl)-3-N-propylbutane-1,3-diamine.
What is the SMILES notation for 1-N,1-N-dimethyl-4-(2-methyltetrazol-5-yl)-3-N-propylbutane-1,3-diamine?
The canonical SMILES for 1-N,1-N-dimethyl-4-(2-methyltetrazol-5-yl)-3-N-propylbutane-1,3-diamine is CCCNC(CCN(C)C)Cc1nnn(C)n1.
What is the InChIKey of 1-N,1-N-dimethyl-4-(2-methyltetrazol-5-yl)-3-N-propylbutane-1,3-diamine?
The InChIKey is YWVJOXLUMYZERR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H24N6/c1-5-7-12-10(6-8-16(2)3)9-11-13-15-17(4)14-11/h10,12H,5-9H2,1-4H3.
What are the key properties of 1-N,1-N-dimethyl-4-(2-methyltetrazol-5-yl)-3-N-propylbutane-1,3-diamine?
1-N,1-N-dimethyl-4-(2-methyltetrazol-5-yl)-3-N-propylbutane-1,3-diamine has a molecular weight of 240.35 g/mol, XLogP of 0.07, 8 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-N,1-N-dimethyl-4-(2-methyltetrazol-5-yl)-3-N-propylbutane-1,3-diamine is sourced from PubChem (CID 107050606), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).