About 4,4-difluoro-5-(2-methoxyethoxymethoxy)hexa-1,5-dien-3-ol
4,4-difluoro-5-(2-methoxyethoxymethoxy)hexa-1,5-dien-3-ol (PubChem CID 10705071) has the molecular formula C10H16F2O4
and a molecular weight of 238.23 g/mol. Its IUPAC name is 4,4-difluoro-5-(2-methoxyethoxymethoxy)hexa-1,5-dien-3-ol.
Molecular Properties
| Compound Name | 4,4-difluoro-5-(2-methoxyethoxymethoxy)hexa-1,5-dien-3-ol |
| PubChem CID | 10705071 |
| Molecular Formula | C10H16F2O4 |
| Molecular Weight | 238.23 g/mol |
| Exact Mass | 238.10 |
| IUPAC Name | 4,4-difluoro-5-(2-methoxyethoxymethoxy)hexa-1,5-dien-3-ol |
| SMILES | C=CC(O)C(F)(F)C(=C)OCOCCOC |
| InChI | InChI=1S/C10H16F2O4/c1-4-9(13)10(11,12)8(2)16-7-15-6-5-14-3/h4,9,13H,1-2,5-7H2,3H3 |
| InChIKey | IMBXEKKNJQRQQZ-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.23 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4,4-difluoro-5-(2-methoxyethoxymethoxy)hexa-1,5-dien-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,4-difluoro-5-(2-methoxyethoxymethoxy)hexa-1,5-dien-3-ol?
The IUPAC name of 4,4-difluoro-5-(2-methoxyethoxymethoxy)hexa-1,5-dien-3-ol (CID 10705071) is 4,4-difluoro-5-(2-methoxyethoxymethoxy)hexa-1,5-dien-3-ol.
What is the SMILES notation for 4,4-difluoro-5-(2-methoxyethoxymethoxy)hexa-1,5-dien-3-ol?
The canonical SMILES for 4,4-difluoro-5-(2-methoxyethoxymethoxy)hexa-1,5-dien-3-ol is C=CC(O)C(F)(F)C(=C)OCOCCOC.
What is the InChIKey of 4,4-difluoro-5-(2-methoxyethoxymethoxy)hexa-1,5-dien-3-ol?
The InChIKey is IMBXEKKNJQRQQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16F2O4/c1-4-9(13)10(11,12)8(2)16-7-15-6-5-14-3/h4,9,13H,1-2,5-7H2,3H3.
What are the key properties of 4,4-difluoro-5-(2-methoxyethoxymethoxy)hexa-1,5-dien-3-ol?
4,4-difluoro-5-(2-methoxyethoxymethoxy)hexa-1,5-dien-3-ol has a molecular weight of 238.23 g/mol, XLogP of 1.32, 9 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4,4-difluoro-5-(2-methoxyethoxymethoxy)hexa-1,5-dien-3-ol is sourced from PubChem (CID 10705071), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).