C14H15Cl2N3O — CID 107050900
3,6-dichloro-2-[3-(3-methylcyclopentyl)-1,2,4-oxadiazol-5-yl]aniline (PubChem CID 107050900) has the molecular formula C14H15Cl2N3O and a molecular weight of 312.20 g/mol. Its IUPAC name is 3,6-dichloro-2-[3-(3-methylcyclopentyl)-1,2,4-oxadiazol-5-yl]aniline.
| Compound Name | 3,6-dichloro-2-[3-(3-methylcyclopentyl)-1,2,4-oxadiazol-5-yl]aniline |
|---|---|
| PubChem CID | 107050900 |
| Molecular Formula | C14H15Cl2N3O |
| Molecular Weight | 312.20 g/mol |
| Exact Mass | 311.06 |
| IUPAC Name | 3,6-dichloro-2-[3-(3-methylcyclopentyl)-1,2,4-oxadiazol-5-yl]aniline |
| SMILES | CC1CCC(c2noc(-c3c(Cl)ccc(Cl)c3N)n2)C1 |
| InChI | InChI=1S/C14H15Cl2N3O/c1-7-2-3-8(6-7)13-18-14(20-19-13)11-9(15)4-5-10(16)12(11)17/h4-5,7-8H,2-3,6,17H2,1H3 |
| InChIKey | PVIIHAVJRKDBQI-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.20 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|