About 2-[(E)-2-(2,5-dimethylphenyl)ethenyl]cyclohexa-2,5-diene-1,4-dione
2-[(E)-2-(2,5-dimethylphenyl)ethenyl]cyclohexa-2,5-diene-1,4-dione (PubChem CID 10705096) has the molecular formula C16H14O2
and a molecular weight of 238.29 g/mol. Its IUPAC name is 2-[(E)-2-(2,5-dimethylphenyl)ethenyl]cyclohexa-2,5-diene-1,4-dione.
Molecular Properties
| Compound Name | 2-[(E)-2-(2,5-dimethylphenyl)ethenyl]cyclohexa-2,5-diene-1,4-dione |
| PubChem CID | 10705096 |
| Molecular Formula | C16H14O2 |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.10 |
| IUPAC Name | 2-[(E)-2-(2,5-dimethylphenyl)ethenyl]cyclohexa-2,5-diene-1,4-dione |
| SMILES | Cc1ccc(C)c(/C=C/C2=CC(=O)C=CC2=O)c1 |
| InChI | InChI=1S/C16H14O2/c1-11-3-4-12(2)13(9-11)5-6-14-10-15(17)7-8-16(14)18/h3-10H,1-2H3/b6-5+ |
| InChIKey | YJVXUWZZCMAGLF-AATRIKPKSA-N |
| XLogP | 2.95 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|
Analyze 2-[(E)-2-(2,5-dimethylphenyl)ethenyl]cyclohexa-2,5-diene-1,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(E)-2-(2,5-dimethylphenyl)ethenyl]cyclohexa-2,5-diene-1,4-dione?
The IUPAC name of 2-[(E)-2-(2,5-dimethylphenyl)ethenyl]cyclohexa-2,5-diene-1,4-dione (CID 10705096) is 2-[(E)-2-(2,5-dimethylphenyl)ethenyl]cyclohexa-2,5-diene-1,4-dione.
What is the SMILES notation for 2-[(E)-2-(2,5-dimethylphenyl)ethenyl]cyclohexa-2,5-diene-1,4-dione?
The canonical SMILES for 2-[(E)-2-(2,5-dimethylphenyl)ethenyl]cyclohexa-2,5-diene-1,4-dione is Cc1ccc(C)c(/C=C/C2=CC(=O)C=CC2=O)c1.
What is the InChIKey of 2-[(E)-2-(2,5-dimethylphenyl)ethenyl]cyclohexa-2,5-diene-1,4-dione?
The InChIKey is YJVXUWZZCMAGLF-AATRIKPKSA-N. The full InChI is InChI=1S/C16H14O2/c1-11-3-4-12(2)13(9-11)5-6-14-10-15(17)7-8-16(14)18/h3-10H,1-2H3/b6-5+.
What are the key properties of 2-[(E)-2-(2,5-dimethylphenyl)ethenyl]cyclohexa-2,5-diene-1,4-dione?
2-[(E)-2-(2,5-dimethylphenyl)ethenyl]cyclohexa-2,5-diene-1,4-dione has a molecular weight of 238.29 g/mol, XLogP of 2.95, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(E)-2-(2,5-dimethylphenyl)ethenyl]cyclohexa-2,5-diene-1,4-dione is sourced from PubChem (CID 10705096), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).