C12H17ClN6 — CID 107051471
N-[1-(3-chloro-2-pyridinyl)-2-(2-methyltetrazol-5-yl)ethyl]propan-1-amine (PubChem CID 107051471) has the molecular formula C12H17ClN6 and a molecular weight of 280.76 g/mol. Its IUPAC name is N-[1-(3-chloro-2-pyridinyl)-2-(2-methyltetrazol-5-yl)ethyl]propan-1-amine.
| Compound Name | N-[1-(3-chloro-2-pyridinyl)-2-(2-methyltetrazol-5-yl)ethyl]propan-1-amine |
|---|---|
| PubChem CID | 107051471 |
| Molecular Formula | C12H17ClN6 |
| Molecular Weight | 280.76 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | N-[1-(3-chloro-2-pyridinyl)-2-(2-methyltetrazol-5-yl)ethyl]propan-1-amine |
| SMILES | CCCNC(Cc1nnn(C)n1)c1ncccc1Cl |
| InChI | InChI=1S/C12H17ClN6/c1-3-6-14-10(8-11-16-18-19(2)17-11)12-9(13)5-4-7-15-12/h4-5,7,10,14H,3,6,8H2,1-2H3 |
| InChIKey | ANOZJAYMEDCFND-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 68.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.76 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |