C10H11N7OS — CID 107052253
2-[(2-methyltetrazol-5-yl)methylsulfinyl]-3H-benzimidazol-5-amine (PubChem CID 107052253) has the molecular formula C10H11N7OS and a molecular weight of 277.31 g/mol. Its IUPAC name is 2-[(2-methyltetrazol-5-yl)methylsulfinyl]-3H-benzimidazol-5-amine.
| Compound Name | 2-[(2-methyltetrazol-5-yl)methylsulfinyl]-3H-benzimidazol-5-amine |
|---|---|
| PubChem CID | 107052253 |
| Molecular Formula | C10H11N7OS |
| Molecular Weight | 277.31 g/mol |
| Exact Mass | 277.07 |
| IUPAC Name | 2-[(2-methyltetrazol-5-yl)methylsulfinyl]-3H-benzimidazol-5-amine |
| SMILES | Cn1nnc(CS(=O)c2nc3ccc(N)cc3[nH]2)n1 |
| InChI | InChI=1S/C10H11N7OS/c1-17-15-9(14-16-17)5-19(18)10-12-7-3-2-6(11)4-8(7)13-10/h2-4H,5,11H2,1H3,(H,12,13) |
| InChIKey | UYCPJFPVIISHLI-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 115.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.31 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|