C9H13N7O2 — CID 107052611
1-[(2-methyltetrazol-5-yl)methyl]-5-propan-2-yltriazole-4-carboxylic acid (PubChem CID 107052611) has the molecular formula C9H13N7O2 and a molecular weight of 251.25 g/mol. Its IUPAC name is 1-[(2-methyltetrazol-5-yl)methyl]-5-propan-2-yltriazole-4-carboxylic acid.
| Compound Name | 1-[(2-methyltetrazol-5-yl)methyl]-5-propan-2-yltriazole-4-carboxylic acid |
|---|---|
| PubChem CID | 107052611 |
| Molecular Formula | C9H13N7O2 |
| Molecular Weight | 251.25 g/mol |
| Exact Mass | 251.11 |
| IUPAC Name | 1-[(2-methyltetrazol-5-yl)methyl]-5-propan-2-yltriazole-4-carboxylic acid |
| SMILES | CC(C)c1c(C(=O)O)nnn1Cc1nnn(C)n1 |
| InChI | InChI=1S/C9H13N7O2/c1-5(2)8-7(9(17)18)11-14-16(8)4-6-10-13-15(3)12-6/h5H,4H2,1-3H3,(H,17,18) |
| InChIKey | NZVWZHQSBLYWBS-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 111.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.25 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |