C9H14N6O — CID 107052776
1-[1-[(1-methyltriazol-4-yl)methyl]triazol-4-yl]propan-1-ol (PubChem CID 107052776) has the molecular formula C9H14N6O and a molecular weight of 222.25 g/mol. Its IUPAC name is 1-[1-[(1-methyltriazol-4-yl)methyl]triazol-4-yl]propan-1-ol.
| Compound Name | 1-[1-[(1-methyltriazol-4-yl)methyl]triazol-4-yl]propan-1-ol |
|---|---|
| PubChem CID | 107052776 |
| Molecular Formula | C9H14N6O |
| Molecular Weight | 222.25 g/mol |
| Exact Mass | 222.12 |
| IUPAC Name | 1-[1-[(1-methyltriazol-4-yl)methyl]triazol-4-yl]propan-1-ol |
| SMILES | CCC(O)c1cn(Cc2cn(C)nn2)nn1 |
| InChI | InChI=1S/C9H14N6O/c1-3-9(16)8-6-15(13-11-8)5-7-4-14(2)12-10-7/h4,6,9,16H,3,5H2,1-2H3 |
| InChIKey | GYFGHDPTRAIUQW-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 81.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.25 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |