C14H19BrN4 — CID 107053010
2-[(3-bromophenyl)methyl]-N-methyl-3-(1-methyltriazol-4-yl)propan-1-amine (PubChem CID 107053010) has the molecular formula C14H19BrN4 and a molecular weight of 323.24 g/mol. Its IUPAC name is 2-[(3-bromophenyl)methyl]-N-methyl-3-(1-methyltriazol-4-yl)propan-1-amine.
| Compound Name | 2-[(3-bromophenyl)methyl]-N-methyl-3-(1-methyltriazol-4-yl)propan-1-amine |
|---|---|
| PubChem CID | 107053010 |
| Molecular Formula | C14H19BrN4 |
| Molecular Weight | 323.24 g/mol |
| Exact Mass | 322.08 |
| IUPAC Name | 2-[(3-bromophenyl)methyl]-N-methyl-3-(1-methyltriazol-4-yl)propan-1-amine |
| SMILES | CNCC(Cc1cccc(Br)c1)Cc1cn(C)nn1 |
| InChI | InChI=1S/C14H19BrN4/c1-16-9-12(8-14-10-19(2)18-17-14)6-11-4-3-5-13(15)7-11/h3-5,7,10,12,16H,6,8-9H2,1-2H3 |
| InChIKey | JQCBRWWPNIIBCP-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.24 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |