C14H16N2S — CID 10705478
N,N-dimethyl-1-(4H-pyrrolo[2,1-c][1,4]benzothiazin-1-yl)methanamine (PubChem CID 10705478) has the molecular formula C14H16N2S and a molecular weight of 244.36 g/mol. Its IUPAC name is N,N-dimethyl-1-(4H-pyrrolo[2,1-c][1,4]benzothiazin-1-yl)methanamine.
| Compound Name | N,N-dimethyl-1-(4H-pyrrolo[2,1-c][1,4]benzothiazin-1-yl)methanamine |
|---|---|
| PubChem CID | 10705478 |
| Molecular Formula | C14H16N2S |
| Molecular Weight | 244.36 g/mol |
| Exact Mass | 244.10 |
| IUPAC Name | N,N-dimethyl-1-(4H-pyrrolo[2,1-c][1,4]benzothiazin-1-yl)methanamine |
| SMILES | CN(C)Cc1ccc2n1-c1ccccc1SC2 |
| InChI | InChI=1S/C14H16N2S/c1-15(2)9-11-7-8-12-10-17-14-6-4-3-5-13(14)16(11)12/h3-8H,9-10H2,1-2H3 |
| InChIKey | WGRUUBKCTBBTLU-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.36 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|