C17H24O — CID 10705483
(1R,2R,5S,8S)-2-methyl-6-methylidenespiro[11-oxatricyclo[6.2.1.01,5]undec-9-ene-7,1'-cyclohexane] (PubChem CID 10705483) has the molecular formula C17H24O and a molecular weight of 244.38 g/mol. Its IUPAC name is (1R,2R,5S,8S)-2-methyl-6-methylidenespiro[11-oxatricyclo[6.2.1.01,5]undec-9-ene-7,1'-cyclohexane].
| Compound Name | (1R,2R,5S,8S)-2-methyl-6-methylidenespiro[11-oxatricyclo[6.2.1.01,5]undec-9-ene-7,1'-cyclohexane] |
|---|---|
| PubChem CID | 10705483 |
| Molecular Formula | C17H24O |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.18 |
| IUPAC Name | (1R,2R,5S,8S)-2-methyl-6-methylidenespiro[11-oxatricyclo[6.2.1.01,5]undec-9-ene-7,1'-cyclohexane] |
| SMILES | C=C1[C@@H]2CC[C@@H](C)[C@@]23C=C[C@H](O3)C12CCCCC2 |
| InChI | InChI=1S/C17H24O/c1-12-6-7-14-13(2)16(9-4-3-5-10-16)15-8-11-17(12,14)18-15/h8,11-12,14-15H,2-7,9-10H2,1H3/t12-,14+,15+,17+/m1/s1 |
| InChIKey | FSHFIHUZXXEFBE-DYWXZXKOSA-N |
| XLogP | 4.25 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|