C11H13F2NO3 — CID 10705513
(2R,3S,5R)-5-(4-amino-2,5-difluorophenyl)-2-(hydroxymethyl)oxolan-3-ol (PubChem CID 10705513) has the molecular formula C11H13F2NO3 and a molecular weight of 245.22 g/mol. Its IUPAC name is (2R,3S,5R)-5-(4-amino-2,5-difluorophenyl)-2-(hydroxymethyl)oxolan-3-ol.
| Compound Name | (2R,3S,5R)-5-(4-amino-2,5-difluorophenyl)-2-(hydroxymethyl)oxolan-3-ol |
|---|---|
| PubChem CID | 10705513 |
| Molecular Formula | C11H13F2NO3 |
| Molecular Weight | 245.22 g/mol |
| Exact Mass | 245.09 |
| IUPAC Name | (2R,3S,5R)-5-(4-amino-2,5-difluorophenyl)-2-(hydroxymethyl)oxolan-3-ol |
| SMILES | Nc1cc(F)c([C@H]2C[C@H](O)[C@@H](CO)O2)cc1F |
| InChI | InChI=1S/C11H13F2NO3/c12-6-2-8(14)7(13)1-5(6)10-3-9(16)11(4-15)17-10/h1-2,9-11,15-16H,3-4,14H2/t9-,10+,11+/m0/s1 |
| InChIKey | DZVUYWQWUYGOHE-HBNTYKKESA-N |
| XLogP | 0.73 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.22 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|