About lithium propan-2-yl N-phenylbenzenecarboximidate
lithium propan-2-yl N-phenylbenzenecarboximidate (PubChem CID 10705517) has the molecular formula C16H16LiNO
and a molecular weight of 245.25 g/mol. Its IUPAC name is lithium propan-2-yl N-phenylbenzenecarboximidate.
Molecular Properties
| Compound Name | lithium propan-2-yl N-phenylbenzenecarboximidate |
| PubChem CID | 10705517 |
| Molecular Formula | C16H16LiNO |
| Molecular Weight | 245.25 g/mol |
| Exact Mass | 245.14 |
| IUPAC Name | lithium propan-2-yl N-phenylbenzenecarboximidate |
| SMILES | CC(C)O/C(=N\c1[c-]cccc1)c1ccccc1.[Li+] |
| InChI | InChI=1S/C16H16NO.Li/c1-13(2)18-16(14-9-5-3-6-10-14)17-15-11-7-4-8-12-15;/h3-11,13H,1-2H3;/q-1;+1/b17-16-; |
| InChIKey | YYRYUTFXRWQRJE-XYJRJTJESA-N |
| XLogP | 0.99 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.25 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze lithium propan-2-yl N-phenylbenzenecarboximidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium propan-2-yl N-phenylbenzenecarboximidate?
The IUPAC name of lithium propan-2-yl N-phenylbenzenecarboximidate (CID 10705517) is lithium propan-2-yl N-phenylbenzenecarboximidate.
What is the SMILES notation for lithium propan-2-yl N-phenylbenzenecarboximidate?
The canonical SMILES for lithium propan-2-yl N-phenylbenzenecarboximidate is CC(C)O/C(=N\c1[c-]cccc1)c1ccccc1.[Li+].
What is the InChIKey of lithium propan-2-yl N-phenylbenzenecarboximidate?
The InChIKey is YYRYUTFXRWQRJE-XYJRJTJESA-N. The full InChI is InChI=1S/C16H16NO.Li/c1-13(2)18-16(14-9-5-3-6-10-14)17-15-11-7-4-8-12-15;/h3-11,13H,1-2H3;/q-1;+1/b17-16-;.
What are the key properties of lithium propan-2-yl N-phenylbenzenecarboximidate?
lithium propan-2-yl N-phenylbenzenecarboximidate has a molecular weight of 245.25 g/mol, XLogP of 0.99, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for lithium propan-2-yl N-phenylbenzenecarboximidate is sourced from PubChem (CID 10705517), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).