About [3-chloro-2-(2,2,6-trimethylmorpholin-4-yl)-4-pyridinyl]methanamine
[3-chloro-2-(2,2,6-trimethylmorpholin-4-yl)-4-pyridinyl]methanamine (PubChem CID 107055393) has the molecular formula C13H20ClN3O
and a molecular weight of 269.78 g/mol. Its IUPAC name is [3-chloro-2-(2,2,6-trimethylmorpholin-4-yl)-4-pyridinyl]methanamine.
Molecular Properties
| Compound Name | [3-chloro-2-(2,2,6-trimethylmorpholin-4-yl)-4-pyridinyl]methanamine |
| PubChem CID | 107055393 |
| Molecular Formula | C13H20ClN3O |
| Molecular Weight | 269.78 g/mol |
| Exact Mass | 269.13 |
| IUPAC Name | [3-chloro-2-(2,2,6-trimethylmorpholin-4-yl)-4-pyridinyl]methanamine |
| SMILES | CC1CN(c2nccc(CN)c2Cl)CC(C)(C)O1 |
| InChI | InChI=1S/C13H20ClN3O/c1-9-7-17(8-13(2,3)18-9)12-11(14)10(6-15)4-5-16-12/h4-5,9H,6-8,15H2,1-3H3 |
| InChIKey | BCKXBVHNGHTMOJ-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 51.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.78 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [3-chloro-2-(2,2,6-trimethylmorpholin-4-yl)-4-pyridinyl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-chloro-2-(2,2,6-trimethylmorpholin-4-yl)-4-pyridinyl]methanamine?
The IUPAC name of [3-chloro-2-(2,2,6-trimethylmorpholin-4-yl)-4-pyridinyl]methanamine (CID 107055393) is [3-chloro-2-(2,2,6-trimethylmorpholin-4-yl)-4-pyridinyl]methanamine.
What is the SMILES notation for [3-chloro-2-(2,2,6-trimethylmorpholin-4-yl)-4-pyridinyl]methanamine?
The canonical SMILES for [3-chloro-2-(2,2,6-trimethylmorpholin-4-yl)-4-pyridinyl]methanamine is CC1CN(c2nccc(CN)c2Cl)CC(C)(C)O1.
What is the InChIKey of [3-chloro-2-(2,2,6-trimethylmorpholin-4-yl)-4-pyridinyl]methanamine?
The InChIKey is BCKXBVHNGHTMOJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20ClN3O/c1-9-7-17(8-13(2,3)18-9)12-11(14)10(6-15)4-5-16-12/h4-5,9H,6-8,15H2,1-3H3.
What are the key properties of [3-chloro-2-(2,2,6-trimethylmorpholin-4-yl)-4-pyridinyl]methanamine?
[3-chloro-2-(2,2,6-trimethylmorpholin-4-yl)-4-pyridinyl]methanamine has a molecular weight of 269.78 g/mol, XLogP of 2.20, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [3-chloro-2-(2,2,6-trimethylmorpholin-4-yl)-4-pyridinyl]methanamine is sourced from PubChem (CID 107055393), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).