C15H28N6 — CID 107056008
2-butan-2-yl-5-cyclopropyl-5-methyl-1-[(2-methyltetrazol-5-yl)methyl]piperazine (PubChem CID 107056008) has the molecular formula C15H28N6 and a molecular weight of 292.43 g/mol. Its IUPAC name is 2-butan-2-yl-5-cyclopropyl-5-methyl-1-[(2-methyltetrazol-5-yl)methyl]piperazine.
| Compound Name | 2-butan-2-yl-5-cyclopropyl-5-methyl-1-[(2-methyltetrazol-5-yl)methyl]piperazine |
|---|---|
| PubChem CID | 107056008 |
| Molecular Formula | C15H28N6 |
| Molecular Weight | 292.43 g/mol |
| Exact Mass | 292.24 |
| IUPAC Name | 2-butan-2-yl-5-cyclopropyl-5-methyl-1-[(2-methyltetrazol-5-yl)methyl]piperazine |
| SMILES | CCC(C)C1CNC(C)(C2CC2)CN1Cc1nnn(C)n1 |
| InChI | InChI=1S/C15H28N6/c1-5-11(2)13-8-16-15(3,12-6-7-12)10-21(13)9-14-17-19-20(4)18-14/h11-13,16H,5-10H2,1-4H3 |
| InChIKey | LQGUTTZRCFSPNK-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 58.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.43 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |