C11H9N3O4 — CID 10705621
5-nitro-4,6,7,8-tetrahydro-1H-cyclopenta[g]quinoxaline-2,3-dione (PubChem CID 10705621) has the molecular formula C11H9N3O4 and a molecular weight of 247.21 g/mol. Its IUPAC name is 5-nitro-4,6,7,8-tetrahydro-1H-cyclopenta[g]quinoxaline-2,3-dione.
| Compound Name | 5-nitro-4,6,7,8-tetrahydro-1H-cyclopenta[g]quinoxaline-2,3-dione |
|---|---|
| PubChem CID | 10705621 |
| Molecular Formula | C11H9N3O4 |
| Molecular Weight | 247.21 g/mol |
| Exact Mass | 247.06 |
| IUPAC Name | 5-nitro-4,6,7,8-tetrahydro-1H-cyclopenta[g]quinoxaline-2,3-dione |
| SMILES | O=c1[nH]c2cc3c(c([N+](=O)[O-])c2[nH]c1=O)CCC3 |
| InChI | InChI=1S/C11H9N3O4/c15-10-11(16)13-8-7(12-10)4-5-2-1-3-6(5)9(8)14(17)18/h4H,1-3H2,(H,12,15)(H,13,16) |
| InChIKey | PGGMADFPEZJSMA-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 108.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.21 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|