C13H7Cl2N3O2 — CID 107056312
2-chloro-5-[(3-chloro-4-cyano-2-pyridinyl)amino]benzoic acid (PubChem CID 107056312) has the molecular formula C13H7Cl2N3O2 and a molecular weight of 308.12 g/mol. Its IUPAC name is 2-chloro-5-[(3-chloro-4-cyano-2-pyridinyl)amino]benzoic acid.
| Compound Name | 2-chloro-5-[(3-chloro-4-cyano-2-pyridinyl)amino]benzoic acid |
|---|---|
| PubChem CID | 107056312 |
| Molecular Formula | C13H7Cl2N3O2 |
| Molecular Weight | 308.12 g/mol |
| Exact Mass | 306.99 |
| IUPAC Name | 2-chloro-5-[(3-chloro-4-cyano-2-pyridinyl)amino]benzoic acid |
| SMILES | N#Cc1ccnc(Nc2ccc(Cl)c(C(=O)O)c2)c1Cl |
| InChI | InChI=1S/C13H7Cl2N3O2/c14-10-2-1-8(5-9(10)13(19)20)18-12-11(15)7(6-16)3-4-17-12/h1-5H,(H,17,18)(H,19,20) |
| InChIKey | OZFUMTSAMLSENO-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 86.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.12 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |