About 6,6-diethyl-3-methyl-1-[(2-methyltetrazol-5-yl)methyl]piperazine-2,5-dione
6,6-diethyl-3-methyl-1-[(2-methyltetrazol-5-yl)methyl]piperazine-2,5-dione (PubChem CID 107056364) has the molecular formula C12H20N6O2
and a molecular weight of 280.33 g/mol. Its IUPAC name is 6,6-diethyl-3-methyl-1-[(2-methyltetrazol-5-yl)methyl]piperazine-2,5-dione.
Molecular Properties
| Compound Name | 6,6-diethyl-3-methyl-1-[(2-methyltetrazol-5-yl)methyl]piperazine-2,5-dione |
| PubChem CID | 107056364 |
| Molecular Formula | C12H20N6O2 |
| Molecular Weight | 280.33 g/mol |
| Exact Mass | 280.16 |
| IUPAC Name | 6,6-diethyl-3-methyl-1-[(2-methyltetrazol-5-yl)methyl]piperazine-2,5-dione |
| SMILES | CCC1(CC)C(=O)NC(C)C(=O)N1Cc1nnn(C)n1 |
| InChI | InChI=1S/C12H20N6O2/c1-5-12(6-2)11(20)13-8(3)10(19)18(12)7-9-14-16-17(4)15-9/h8H,5-7H2,1-4H3,(H,13,20) |
| InChIKey | UKDVHHKKUKKVJI-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 93.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.33 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 6,6-diethyl-3-methyl-1-[(2-methyltetrazol-5-yl)methyl]piperazine-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,6-diethyl-3-methyl-1-[(2-methyltetrazol-5-yl)methyl]piperazine-2,5-dione?
The IUPAC name of 6,6-diethyl-3-methyl-1-[(2-methyltetrazol-5-yl)methyl]piperazine-2,5-dione (CID 107056364) is 6,6-diethyl-3-methyl-1-[(2-methyltetrazol-5-yl)methyl]piperazine-2,5-dione.
What is the SMILES notation for 6,6-diethyl-3-methyl-1-[(2-methyltetrazol-5-yl)methyl]piperazine-2,5-dione?
The canonical SMILES for 6,6-diethyl-3-methyl-1-[(2-methyltetrazol-5-yl)methyl]piperazine-2,5-dione is CCC1(CC)C(=O)NC(C)C(=O)N1Cc1nnn(C)n1.
What is the InChIKey of 6,6-diethyl-3-methyl-1-[(2-methyltetrazol-5-yl)methyl]piperazine-2,5-dione?
The InChIKey is UKDVHHKKUKKVJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20N6O2/c1-5-12(6-2)11(20)13-8(3)10(19)18(12)7-9-14-16-17(4)15-9/h8H,5-7H2,1-4H3,(H,13,20).
What are the key properties of 6,6-diethyl-3-methyl-1-[(2-methyltetrazol-5-yl)methyl]piperazine-2,5-dione?
6,6-diethyl-3-methyl-1-[(2-methyltetrazol-5-yl)methyl]piperazine-2,5-dione has a molecular weight of 280.33 g/mol, XLogP of -0.38, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6,6-diethyl-3-methyl-1-[(2-methyltetrazol-5-yl)methyl]piperazine-2,5-dione is sourced from PubChem (CID 107056364), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).