C14H26N4 — CID 107057422
[1-[(1-methyltriazol-4-yl)methyl]-4-propan-2-ylcyclohexyl]methanamine (PubChem CID 107057422) has the molecular formula C14H26N4 and a molecular weight of 250.39 g/mol. Its IUPAC name is [1-[(1-methyltriazol-4-yl)methyl]-4-propan-2-ylcyclohexyl]methanamine.
| Compound Name | [1-[(1-methyltriazol-4-yl)methyl]-4-propan-2-ylcyclohexyl]methanamine |
|---|---|
| PubChem CID | 107057422 |
| Molecular Formula | C14H26N4 |
| Molecular Weight | 250.39 g/mol |
| Exact Mass | 250.22 |
| IUPAC Name | [1-[(1-methyltriazol-4-yl)methyl]-4-propan-2-ylcyclohexyl]methanamine |
| SMILES | CC(C)C1CCC(CN)(Cc2cn(C)nn2)CC1 |
| InChI | InChI=1S/C14H26N4/c1-11(2)12-4-6-14(10-15,7-5-12)8-13-9-18(3)17-16-13/h9,11-12H,4-8,10,15H2,1-3H3 |
| InChIKey | WJVWONYVAKFCPN-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.39 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |