About 2,6-dibromo-N,N-diethyl-4-methylbenzenesulfonamide
2,6-dibromo-N,N-diethyl-4-methylbenzenesulfonamide (PubChem CID 1070580) has the molecular formula C11H15Br2NO2S
and a molecular weight of 385.12 g/mol. Its IUPAC name is 2,6-dibromo-N,N-diethyl-4-methylbenzenesulfonamide.
Molecular Properties
| Compound Name | 2,6-dibromo-N,N-diethyl-4-methylbenzenesulfonamide |
| PubChem CID | 1070580 |
| Molecular Formula | C11H15Br2NO2S |
| Molecular Weight | 385.12 g/mol |
| Exact Mass | 382.92 |
| IUPAC Name | 2,6-dibromo-N,N-diethyl-4-methylbenzenesulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1c(Br)cc(C)cc1Br |
| InChI | InChI=1S/C11H15Br2NO2S/c1-4-14(5-2)17(15,16)11-9(12)6-8(3)7-10(11)13/h6-7H,4-5H2,1-3H3 |
| InChIKey | BRJPSPQURRPJEA-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 385.12 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,6-dibromo-N,N-diethyl-4-methylbenzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-dibromo-N,N-diethyl-4-methylbenzenesulfonamide?
The IUPAC name of 2,6-dibromo-N,N-diethyl-4-methylbenzenesulfonamide (CID 1070580) is 2,6-dibromo-N,N-diethyl-4-methylbenzenesulfonamide.
What is the SMILES notation for 2,6-dibromo-N,N-diethyl-4-methylbenzenesulfonamide?
The canonical SMILES for 2,6-dibromo-N,N-diethyl-4-methylbenzenesulfonamide is CCN(CC)S(=O)(=O)c1c(Br)cc(C)cc1Br.
What is the InChIKey of 2,6-dibromo-N,N-diethyl-4-methylbenzenesulfonamide?
The InChIKey is BRJPSPQURRPJEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15Br2NO2S/c1-4-14(5-2)17(15,16)11-9(12)6-8(3)7-10(11)13/h6-7H,4-5H2,1-3H3.
What are the key properties of 2,6-dibromo-N,N-diethyl-4-methylbenzenesulfonamide?
2,6-dibromo-N,N-diethyl-4-methylbenzenesulfonamide has a molecular weight of 385.12 g/mol, XLogP of 3.55, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-dibromo-N,N-diethyl-4-methylbenzenesulfonamide is sourced from PubChem (CID 1070580), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).