C12H12ClN3 — CID 107058411
3-chloro-2-(hex-5-yn-3-ylamino)pyridine-4-carbonitrile (PubChem CID 107058411) has the molecular formula C12H12ClN3 and a molecular weight of 233.70 g/mol. Its IUPAC name is 3-chloro-2-(hex-5-yn-3-ylamino)pyridine-4-carbonitrile.
| Compound Name | 3-chloro-2-(hex-5-yn-3-ylamino)pyridine-4-carbonitrile |
|---|---|
| PubChem CID | 107058411 |
| Molecular Formula | C12H12ClN3 |
| Molecular Weight | 233.70 g/mol |
| Exact Mass | 233.07 |
| IUPAC Name | 3-chloro-2-(hex-5-yn-3-ylamino)pyridine-4-carbonitrile |
| SMILES | C#CCC(CC)Nc1nccc(C#N)c1Cl |
| InChI | InChI=1S/C12H12ClN3/c1-3-5-10(4-2)16-12-11(13)9(8-14)6-7-15-12/h1,6-7,10H,4-5H2,2H3,(H,15,16) |
| InChIKey | WIXWFAASPUBCRI-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.70 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|