C16H26O2 — CID 10705847
2-[(1S,2R)-1-ethenyl-2-prop-2-enylcyclohexyl]oxyoxane (PubChem CID 10705847) has the molecular formula C16H26O2 and a molecular weight of 250.38 g/mol. Its IUPAC name is 2-[(1S,2R)-1-ethenyl-2-prop-2-enylcyclohexyl]oxyoxane.
| Compound Name | 2-[(1S,2R)-1-ethenyl-2-prop-2-enylcyclohexyl]oxyoxane |
|---|---|
| PubChem CID | 10705847 |
| Molecular Formula | C16H26O2 |
| Molecular Weight | 250.38 g/mol |
| Exact Mass | 250.19 |
| IUPAC Name | 2-[(1S,2R)-1-ethenyl-2-prop-2-enylcyclohexyl]oxyoxane |
| SMILES | C=CC[C@H]1CCCC[C@@]1(C=C)OC1CCCCO1 |
| InChI | InChI=1S/C16H26O2/c1-3-9-14-10-5-7-12-16(14,4-2)18-15-11-6-8-13-17-15/h3-4,14-15H,1-2,5-13H2/t14-,15?,16+/m0/s1 |
| InChIKey | GSUYRHLDASJLEV-DLDKDUQYSA-N |
| XLogP | 4.22 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.38 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|