About (Z)-N,4-dimethyl-5-(2-methyltetrazol-5-yl)pent-3-en-1-amine
(Z)-N,4-dimethyl-5-(2-methyltetrazol-5-yl)pent-3-en-1-amine (PubChem CID 107058736) has the molecular formula C9H17N5
and a molecular weight of 195.27 g/mol. Its IUPAC name is (Z)-N,4-dimethyl-5-(2-methyltetrazol-5-yl)pent-3-en-1-amine.
Molecular Properties
| Compound Name | (Z)-N,4-dimethyl-5-(2-methyltetrazol-5-yl)pent-3-en-1-amine |
| PubChem CID | 107058736 |
| Molecular Formula | C9H17N5 |
| Molecular Weight | 195.27 g/mol |
| Exact Mass | 195.15 |
| IUPAC Name | (Z)-N,4-dimethyl-5-(2-methyltetrazol-5-yl)pent-3-en-1-amine |
| SMILES | CNCC/C=C(/C)Cc1nnn(C)n1 |
| InChI | InChI=1S/C9H17N5/c1-8(5-4-6-10-2)7-9-11-13-14(3)12-9/h5,10H,4,6-7H2,1-3H3/b8-5- |
| InChIKey | LUMHBPUNWIZJJA-YVMONPNESA-N |
| XLogP | 0.31 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.27 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (Z)-N,4-dimethyl-5-(2-methyltetrazol-5-yl)pent-3-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-N,4-dimethyl-5-(2-methyltetrazol-5-yl)pent-3-en-1-amine?
The IUPAC name of (Z)-N,4-dimethyl-5-(2-methyltetrazol-5-yl)pent-3-en-1-amine (CID 107058736) is (Z)-N,4-dimethyl-5-(2-methyltetrazol-5-yl)pent-3-en-1-amine.
What is the SMILES notation for (Z)-N,4-dimethyl-5-(2-methyltetrazol-5-yl)pent-3-en-1-amine?
The canonical SMILES for (Z)-N,4-dimethyl-5-(2-methyltetrazol-5-yl)pent-3-en-1-amine is CNCC/C=C(/C)Cc1nnn(C)n1.
What is the InChIKey of (Z)-N,4-dimethyl-5-(2-methyltetrazol-5-yl)pent-3-en-1-amine?
The InChIKey is LUMHBPUNWIZJJA-YVMONPNESA-N. The full InChI is InChI=1S/C9H17N5/c1-8(5-4-6-10-2)7-9-11-13-14(3)12-9/h5,10H,4,6-7H2,1-3H3/b8-5-.
What are the key properties of (Z)-N,4-dimethyl-5-(2-methyltetrazol-5-yl)pent-3-en-1-amine?
(Z)-N,4-dimethyl-5-(2-methyltetrazol-5-yl)pent-3-en-1-amine has a molecular weight of 195.27 g/mol, XLogP of 0.31, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-N,4-dimethyl-5-(2-methyltetrazol-5-yl)pent-3-en-1-amine is sourced from PubChem (CID 107058736), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).