C12H19ClN4 — CID 107060104
3-chloro-2-[ethyl(2-methylpropyl)amino]pyridine-4-carboximidamide (PubChem CID 107060104) has the molecular formula C12H19ClN4 and a molecular weight of 254.76 g/mol. Its IUPAC name is 3-chloro-2-[ethyl(2-methylpropyl)amino]pyridine-4-carboximidamide.
| Compound Name | 3-chloro-2-[ethyl(2-methylpropyl)amino]pyridine-4-carboximidamide |
|---|---|
| PubChem CID | 107060104 |
| Molecular Formula | C12H19ClN4 |
| Molecular Weight | 254.76 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | 3-chloro-2-[ethyl(2-methylpropyl)amino]pyridine-4-carboximidamide |
| SMILES | [H]/N=C(\N)c1ccnc(N(CC)CC(C)C)c1Cl |
| InChI | InChI=1S/C12H19ClN4/c1-4-17(7-8(2)3)12-10(13)9(11(14)15)5-6-16-12/h5-6,8H,4,7H2,1-3H3,(H3,14,15) |
| InChIKey | GNTGIMCUIUVYIS-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 66.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.76 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|