C13H19NO4 — CID 10706031
benzyl N-[(2S)-1,3-dihydroxy-3-methylbutan-2-yl]carbamate (PubChem CID 10706031) has the molecular formula C13H19NO4 and a molecular weight of 253.30 g/mol. Its IUPAC name is benzyl N-[(2S)-1,3-dihydroxy-3-methylbutan-2-yl]carbamate.
| Compound Name | benzyl N-[(2S)-1,3-dihydroxy-3-methylbutan-2-yl]carbamate |
|---|---|
| PubChem CID | 10706031 |
| Molecular Formula | C13H19NO4 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.13 |
| IUPAC Name | benzyl N-[(2S)-1,3-dihydroxy-3-methylbutan-2-yl]carbamate |
| SMILES | CC(C)(O)[C@H](CO)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C13H19NO4/c1-13(2,17)11(8-15)14-12(16)18-9-10-6-4-3-5-7-10/h3-7,11,15,17H,8-9H2,1-2H3,(H,14,16)/t11-/m0/s1 |
| InChIKey | GSSZECAGHJDVGM-NSHDSACASA-N |
| XLogP | 1.04 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |