C12H8ClF2N3O — CID 107060553
3-chloro-2-(3,4-difluorophenoxy)pyridine-4-carboximidamide (PubChem CID 107060553) has the molecular formula C12H8ClF2N3O and a molecular weight of 283.67 g/mol. Its IUPAC name is 3-chloro-2-(3,4-difluorophenoxy)pyridine-4-carboximidamide.
| Compound Name | 3-chloro-2-(3,4-difluorophenoxy)pyridine-4-carboximidamide |
|---|---|
| PubChem CID | 107060553 |
| Molecular Formula | C12H8ClF2N3O |
| Molecular Weight | 283.67 g/mol |
| Exact Mass | 283.03 |
| IUPAC Name | 3-chloro-2-(3,4-difluorophenoxy)pyridine-4-carboximidamide |
| SMILES | [H]/N=C(\N)c1ccnc(Oc2ccc(F)c(F)c2)c1Cl |
| InChI | InChI=1S/C12H8ClF2N3O/c13-10-7(11(16)17)3-4-18-12(10)19-6-1-2-8(14)9(15)5-6/h1-5H,(H3,16,17) |
| InChIKey | KFRUXIKVECVSRX-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 71.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.67 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|