C8H8ClN3O2S2 — CID 107061618
2-[(3-chloro-4-cyano-2-pyridinyl)sulfanyl]ethanesulfonamide (PubChem CID 107061618) has the molecular formula C8H8ClN3O2S2 and a molecular weight of 277.76 g/mol. Its IUPAC name is 2-[(3-chloro-4-cyano-2-pyridinyl)sulfanyl]ethanesulfonamide.
| Compound Name | 2-[(3-chloro-4-cyano-2-pyridinyl)sulfanyl]ethanesulfonamide |
|---|---|
| PubChem CID | 107061618 |
| Molecular Formula | C8H8ClN3O2S2 |
| Molecular Weight | 277.76 g/mol |
| Exact Mass | 276.97 |
| IUPAC Name | 2-[(3-chloro-4-cyano-2-pyridinyl)sulfanyl]ethanesulfonamide |
| SMILES | N#Cc1ccnc(SCCS(N)(=O)=O)c1Cl |
| InChI | InChI=1S/C8H8ClN3O2S2/c9-7-6(5-10)1-2-12-8(7)15-3-4-16(11,13)14/h1-2H,3-4H2,(H2,11,13,14) |
| InChIKey | XXUCNTDAJUMQDP-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 96.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.76 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |