About 7-amino-5,5-dimethyl-1-(2-methyltetrazol-5-yl)heptan-2-one
7-amino-5,5-dimethyl-1-(2-methyltetrazol-5-yl)heptan-2-one (PubChem CID 107062083) has the molecular formula C11H21N5O
and a molecular weight of 239.32 g/mol. Its IUPAC name is 7-amino-5,5-dimethyl-1-(2-methyltetrazol-5-yl)heptan-2-one.
Molecular Properties
| Compound Name | 7-amino-5,5-dimethyl-1-(2-methyltetrazol-5-yl)heptan-2-one |
| PubChem CID | 107062083 |
| Molecular Formula | C11H21N5O |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.17 |
| IUPAC Name | 7-amino-5,5-dimethyl-1-(2-methyltetrazol-5-yl)heptan-2-one |
| SMILES | Cn1nnc(CC(=O)CCC(C)(C)CCN)n1 |
| InChI | InChI=1S/C11H21N5O/c1-11(2,6-7-12)5-4-9(17)8-10-13-15-16(3)14-10/h4-8,12H2,1-3H3 |
| InChIKey | DEKQLZHRNKTWHG-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 86.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 7-amino-5,5-dimethyl-1-(2-methyltetrazol-5-yl)heptan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-amino-5,5-dimethyl-1-(2-methyltetrazol-5-yl)heptan-2-one?
The IUPAC name of 7-amino-5,5-dimethyl-1-(2-methyltetrazol-5-yl)heptan-2-one (CID 107062083) is 7-amino-5,5-dimethyl-1-(2-methyltetrazol-5-yl)heptan-2-one.
What is the SMILES notation for 7-amino-5,5-dimethyl-1-(2-methyltetrazol-5-yl)heptan-2-one?
The canonical SMILES for 7-amino-5,5-dimethyl-1-(2-methyltetrazol-5-yl)heptan-2-one is Cn1nnc(CC(=O)CCC(C)(C)CCN)n1.
What is the InChIKey of 7-amino-5,5-dimethyl-1-(2-methyltetrazol-5-yl)heptan-2-one?
The InChIKey is DEKQLZHRNKTWHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21N5O/c1-11(2,6-7-12)5-4-9(17)8-10-13-15-16(3)14-10/h4-8,12H2,1-3H3.
What are the key properties of 7-amino-5,5-dimethyl-1-(2-methyltetrazol-5-yl)heptan-2-one?
7-amino-5,5-dimethyl-1-(2-methyltetrazol-5-yl)heptan-2-one has a molecular weight of 239.32 g/mol, XLogP of 0.48, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 7-amino-5,5-dimethyl-1-(2-methyltetrazol-5-yl)heptan-2-one is sourced from PubChem (CID 107062083), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).